C32H36O7 — CID 45482096
(1S)-1-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]prop-2-en-1-ol (PubChem CID 45482096) has the molecular formula C32H36O7 and a molecular weight of 532.63 g/mol. Its IUPAC name is (1S)-1-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]prop-2-en-1-ol.
| Compound Name | (1S)-1-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 45482096 |
| Molecular Formula | C32H36O7 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (1S)-1-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]prop-2-en-1-ol |
| SMILES | C=C[C@H](O)[C@@H]1O[C@H](OC)[C@@H]2OC[C@H](OCc3ccccc3)[C@]2(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H36O7/c1-3-26(33)28-29(36-20-24-15-9-5-10-16-24)32(38-21-25-17-11-6-12-18-25)27(22-37-30(32)31(34-2)39-28)35-19-23-13-7-4-8-14-23/h3-18,26-31,33H,1,19-22H2,2H3/t26-,27-,28-,29+,30-,31-,32-/m0/s1 |
| InChIKey | IJKSSCBBAGFHNZ-FESSDJLHSA-N |
| XLogP | 4.43 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|