C38H39N3O8 — CID 45482102
benzyl (2R)-2-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-azidoacetate (PubChem CID 45482102) has the molecular formula C38H39N3O8 and a molecular weight of 665.74 g/mol. Its IUPAC name is benzyl (2R)-2-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-azidoacetate.
| Compound Name | benzyl (2R)-2-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-azidoacetate |
|---|---|
| PubChem CID | 45482102 |
| Molecular Formula | C38H39N3O8 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | benzyl (2R)-2-[(3S,3aS,4R,5S,7S,7aR)-7-methoxy-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-azidoacetate |
| SMILES | CO[C@H]1O[C@@H]([C@@H](N=[N+]=[N-])C(=O)OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@]2(OCc3ccccc3)[C@@H](OCc3ccccc3)CO[C@@H]12 |
| InChI | InChI=1S/C38H39N3O8/c1-43-37-35-38(48-25-30-20-12-5-13-21-30,31(26-46-35)44-22-27-14-6-2-7-15-27)34(45-23-28-16-8-3-9-17-28)33(49-37)32(40-41-39)36(42)47-24-29-18-10-4-11-19-29/h2-21,31-35,37H,22-26H2,1H3/t31-,32+,33-,34+,35-,37-,38-/m0/s1 |
| InChIKey | RVUSMHLGTHKPQD-LEVNGWQZSA-N |
| XLogP | 6.31 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|