C38H38ClN5O8 — CID 45482104
[(3S,3aS,4R,5R,7R,7aR)-7-(2-acetamido-6-chloropurin-7-yl)-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate (PubChem CID 45482104) has the molecular formula C38H38ClN5O8 and a molecular weight of 728.20 g/mol. Its IUPAC name is [(3S,3aS,4R,5R,7R,7aR)-7-(2-acetamido-6-chloropurin-7-yl)-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate.
| Compound Name | [(3S,3aS,4R,5R,7R,7aR)-7-(2-acetamido-6-chloropurin-7-yl)-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 45482104 |
| Molecular Formula | C38H38ClN5O8 |
| Molecular Weight | 728.20 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | [(3S,3aS,4R,5R,7R,7aR)-7-(2-acetamido-6-chloropurin-7-yl)-3,3a,4-tris(phenylmethoxy)-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate |
| SMILES | CC(=O)Nc1nc(Cl)c2c(ncn2[C@@H]2O[C@H](COC(C)=O)[C@@H](OCc3ccccc3)[C@@]3(OCc4ccccc4)[C@@H](OCc4ccccc4)CO[C@@H]23)n1 |
| InChI | InChI=1S/C38H38ClN5O8/c1-24(45)41-37-42-34(39)31-35(43-37)40-23-44(31)36-33-38(51-20-28-16-10-5-11-17-28,30(22-50-33)48-18-26-12-6-3-7-13-26)32(29(52-36)21-47-25(2)46)49-19-27-14-8-4-9-15-27/h3-17,23,29-30,32-33,36H,18-22H2,1-2H3,(H,41,42,43,45)/t29-,30+,32-,33+,36-,38+/m1/s1 |
| InChIKey | VUMJTHCZKOQMNN-ARDXOGRLSA-N |
| XLogP | 5.42 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.20 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |