C17H24O11 — CID 45482115
[(3S,3aS,4R,5R,7S,7aR)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate (PubChem CID 45482115) has the molecular formula C17H24O11 and a molecular weight of 404.37 g/mol. Its IUPAC name is [(3S,3aS,4R,5R,7S,7aR)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate.
| Compound Name | [(3S,3aS,4R,5R,7S,7aR)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 45482115 |
| Molecular Formula | C17H24O11 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | [(3S,3aS,4R,5R,7S,7aR)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@]2(OC(C)=O)[C@@H](OC(C)=O)CO[C@@H]12 |
| InChI | InChI=1S/C17H24O11/c1-8(18)23-6-12-14(26-10(3)20)17(28-11(4)21)13(25-9(2)19)7-24-15(17)16(22-5)27-12/h12-16H,6-7H2,1-5H3/t12-,13+,14-,15+,16+,17+/m1/s1 |
| InChIKey | YPNHDPUGTBBDTP-DZTUFKMZSA-N |
| XLogP | -0.52 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|