About (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine
(2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine (PubChem CID 45482257) has the molecular formula C23H47N3
and a molecular weight of 365.65 g/mol. Its IUPAC name is (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine |
| PubChem CID | 45482257 |
| Molecular Formula | C23H47N3 |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.38 |
| IUPAC Name | (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)[C@@H](CNC)N1CCN(CCCC2CCCCC2)[C@H](C(C)C)C1 |
| InChI | InChI=1S/C23H47N3/c1-6-20(4)22(17-24-5)26-16-15-25(23(18-26)19(2)3)14-10-13-21-11-8-7-9-12-21/h19-24H,6-18H2,1-5H3/t20?,22-,23+/m1/s1 |
| InChIKey | WDWUDQLDYWBWLS-LQKDOSGMSA-N |
| XLogP | 4.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine?
The IUPAC name of (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine (CID 45482257) is (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine.
What is the SMILES notation for (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine?
The canonical SMILES for (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine is CCC(C)[C@@H](CNC)N1CCN(CCCC2CCCCC2)[C@H](C(C)C)C1.
What is the InChIKey of (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine?
The InChIKey is WDWUDQLDYWBWLS-LQKDOSGMSA-N. The full InChI is InChI=1S/C23H47N3/c1-6-20(4)22(17-24-5)26-16-15-25(23(18-26)19(2)3)14-10-13-21-11-8-7-9-12-21/h19-24H,6-18H2,1-5H3/t20?,22-,23+/m1/s1.
What are the key properties of (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine?
(2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine has a molecular weight of 365.65 g/mol, XLogP of 4.62, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3R)-4-(3-cyclohexylpropyl)-3-propan-2-ylpiperazin-1-yl]-N,3-dimethylpentan-1-amine is sourced from PubChem (CID 45482257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).