About 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate
4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 45482568) has the molecular formula C20H17NO6
and a molecular weight of 367.36 g/mol. Its IUPAC name is 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate |
| PubChem CID | 45482568 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2ccnc3cc(OC)cc(OC)c23)cc1 |
| InChI | InChI=1S/C20H17NO6/c1-24-14-10-15-18(17(11-14)25-2)16(8-9-21-15)27-20(23)13-6-4-12(5-7-13)19(22)26-3/h4-11H,1-3H3 |
| InChIKey | KLOZOHUOAZCVCO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate?
The IUPAC name of 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate (CID 45482568) is 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate.
What is the SMILES notation for 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate?
The canonical SMILES for 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate is COC(=O)c1ccc(C(=O)Oc2ccnc3cc(OC)cc(OC)c23)cc1.
What is the InChIKey of 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate?
The InChIKey is KLOZOHUOAZCVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO6/c1-24-14-10-15-18(17(11-14)25-2)16(8-9-21-15)27-20(23)13-6-4-12(5-7-13)19(22)26-3/h4-11H,1-3H3.
What are the key properties of 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate?
4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate has a molecular weight of 367.36 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(5,7-dimethoxyquinolin-4-yl) 1-O-methyl benzene-1,4-dicarboxylate is sourced from PubChem (CID 45482568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).