C23H18N4O — CID 45482646
2-[3-(3-hydroxy-5-methylphenyl)-4-(2-phenyl-4-pyridinyl)pyrazol-1-yl]acetonitrile (PubChem CID 45482646) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[3-(3-hydroxy-5-methylphenyl)-4-(2-phenyl-4-pyridinyl)pyrazol-1-yl]acetonitrile.
| Compound Name | 2-[3-(3-hydroxy-5-methylphenyl)-4-(2-phenyl-4-pyridinyl)pyrazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 45482646 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[3-(3-hydroxy-5-methylphenyl)-4-(2-phenyl-4-pyridinyl)pyrazol-1-yl]acetonitrile |
| SMILES | Cc1cc(O)cc(-c2nn(CC#N)cc2-c2ccnc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H18N4O/c1-16-11-19(13-20(28)12-16)23-21(15-27(26-23)10-8-24)18-7-9-25-22(14-18)17-5-3-2-4-6-17/h2-7,9,11-15,28H,10H2,1H3 |
| InChIKey | NNGXDAOQBNIWDC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |