About 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide
2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide (PubChem CID 45482648) has the molecular formula C17H14BrF2N5O2S
and a molecular weight of 470.30 g/mol. Its IUPAC name is 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| PubChem CID | 45482648 |
| Molecular Formula | C17H14BrF2N5O2S |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(F)cc2F)ncc1Br |
| InChI | InChI=1S/C17H14BrF2N5O2S/c1-21-28(26,27)15-5-3-2-4-14(15)23-16-11(18)9-22-17(25-16)24-13-7-6-10(19)8-12(13)20/h2-9,21H,1H3,(H2,22,23,24,25) |
| InChIKey | YXMUIXGURFNGQP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide?
The IUPAC name of 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide (CID 45482648) is 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide.
What is the SMILES notation for 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide?
The canonical SMILES for 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide is CNS(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(F)cc2F)ncc1Br.
What is the InChIKey of 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide?
The InChIKey is YXMUIXGURFNGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrF2N5O2S/c1-21-28(26,27)15-5-3-2-4-14(15)23-16-11(18)9-22-17(25-16)24-13-7-6-10(19)8-12(13)20/h2-9,21H,1H3,(H2,22,23,24,25).
What are the key properties of 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide?
2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide has a molecular weight of 470.30 g/mol, XLogP of 3.91, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-bromo-2-(2,4-difluoroanilino)pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide is sourced from PubChem (CID 45482648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).