C11H16N4 — CID 45482665
(6-methyl-4-phenyl-1,2,3,4-tetrahydropyrimidin-2-yl)hydrazine (PubChem CID 45482665) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is (6-methyl-4-phenyl-1,2,3,4-tetrahydropyrimidin-2-yl)hydrazine.
| Compound Name | (6-methyl-4-phenyl-1,2,3,4-tetrahydropyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 45482665 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (6-methyl-4-phenyl-1,2,3,4-tetrahydropyrimidin-2-yl)hydrazine |
| SMILES | CC1=CC(c2ccccc2)NC(NN)N1 |
| InChI | InChI=1S/C11H16N4/c1-8-7-10(14-11(13-8)15-12)9-5-3-2-4-6-9/h2-7,10-11,13-15H,12H2,1H3 |
| InChIKey | YRZUEJBQVDVCOU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|