C21H24FN5S — CID 45482685
6-(2-fluoro-4-pyridinyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 45482685) has the molecular formula C21H24FN5S and a molecular weight of 397.52 g/mol. Its IUPAC name is 6-(2-fluoro-4-pyridinyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 6-(2-fluoro-4-pyridinyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 45482685 |
| Molecular Formula | C21H24FN5S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 6-(2-fluoro-4-pyridinyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Fc1cc(-c2cnc3nc(N4CCC(N5CCCCC5)CC4)sc3c2)ccn1 |
| InChI | InChI=1S/C21H24FN5S/c22-19-13-15(4-7-23-19)16-12-18-20(24-14-16)25-21(28-18)27-10-5-17(6-11-27)26-8-2-1-3-9-26/h4,7,12-14,17H,1-3,5-6,8-11H2 |
| InChIKey | OJFKDXVECGWNTB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|