About 4,9-dihydro-2H-triazolo[4,5-g]quinoline
4,9-dihydro-2H-triazolo[4,5-g]quinoline (PubChem CID 45482701) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 4,9-dihydro-2H-triazolo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 4,9-dihydro-2H-triazolo[4,5-g]quinoline |
| PubChem CID | 45482701 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4,9-dihydro-2H-triazolo[4,5-g]quinoline |
| SMILES | c1cnc2c(c1)Cc1n[nH]nc1C2 |
| InChI | InChI=1S/C9H8N4/c1-2-6-4-8-9(12-13-11-8)5-7(6)10-3-1/h1-3H,4-5H2,(H,11,12,13) |
| InChIKey | OKOFWKCIVUPRPW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,9-dihydro-2H-triazolo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dihydro-2H-triazolo[4,5-g]quinoline?
The IUPAC name of 4,9-dihydro-2H-triazolo[4,5-g]quinoline (CID 45482701) is 4,9-dihydro-2H-triazolo[4,5-g]quinoline.
What is the SMILES notation for 4,9-dihydro-2H-triazolo[4,5-g]quinoline?
The canonical SMILES for 4,9-dihydro-2H-triazolo[4,5-g]quinoline is c1cnc2c(c1)Cc1n[nH]nc1C2.
What is the InChIKey of 4,9-dihydro-2H-triazolo[4,5-g]quinoline?
The InChIKey is OKOFWKCIVUPRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-2-6-4-8-9(12-13-11-8)5-7(6)10-3-1/h1-3H,4-5H2,(H,11,12,13).
What are the key properties of 4,9-dihydro-2H-triazolo[4,5-g]quinoline?
4,9-dihydro-2H-triazolo[4,5-g]quinoline has a molecular weight of 172.19 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dihydro-2H-triazolo[4,5-g]quinoline is sourced from PubChem (CID 45482701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).