About 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine
5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine (PubChem CID 45482752) has the molecular formula C20H25N7S
and a molecular weight of 395.54 g/mol. Its IUPAC name is 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine |
| PubChem CID | 45482752 |
| Molecular Formula | C20H25N7S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2cnc3nc(N4CCC(N5CCCCC5)CC4)sc3c2)cn1 |
| InChI | InChI=1S/C20H25N7S/c21-18-13-22-16(12-23-18)14-10-17-19(24-11-14)25-20(28-17)27-8-4-15(5-9-27)26-6-2-1-3-7-26/h10-13,15H,1-9H2,(H2,21,23) |
| InChIKey | CFCMQQZGILKVFV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine?
The IUPAC name of 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine (CID 45482752) is 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine.
What is the SMILES notation for 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine?
The canonical SMILES for 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine is Nc1cnc(-c2cnc3nc(N4CCC(N5CCCCC5)CC4)sc3c2)cn1.
What is the InChIKey of 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine?
The InChIKey is CFCMQQZGILKVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N7S/c21-18-13-22-16(12-23-18)14-10-17-19(24-11-14)25-20(28-17)27-8-4-15(5-9-27)26-6-2-1-3-7-26/h10-13,15H,1-9H2,(H2,21,23).
What are the key properties of 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine?
5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine has a molecular weight of 395.54 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]thiazolo[4,5-b]pyridin-6-yl]pyrazin-2-amine is sourced from PubChem (CID 45482752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).