C19H10BrF6NO3S — CID 45482833
(5Z)-5-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 45482833) has the molecular formula C19H10BrF6NO3S and a molecular weight of 526.25 g/mol. Its IUPAC name is (5Z)-5-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 45482833 |
| Molecular Formula | C19H10BrF6NO3S |
| Molecular Weight | 526.25 g/mol |
| Exact Mass | 524.95 |
| IUPAC Name | (5Z)-5-[[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(Br)ccc2OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C19H10BrF6NO3S/c20-13-1-2-14(10(5-13)6-15-16(28)27-17(29)31-15)30-8-9-3-11(18(21,22)23)7-12(4-9)19(24,25)26/h1-7H,8H2,(H,27,28,29)/b15-6- |
| InChIKey | FZRDTEBLFOXQQJ-UUASQNMZSA-N |
| XLogP | 6.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.25 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|