C30H34ClN3O5S — CID 45482848
ethyl 6-(4-chlorobenzoyl)-3,5-bis[4-(dimethylamino)phenyl]-1,1-dioxo-1,4-thiazinane-2-carboxylate (PubChem CID 45482848) has the molecular formula C30H34ClN3O5S and a molecular weight of 584.14 g/mol. Its IUPAC name is ethyl 6-(4-chlorobenzoyl)-3,5-bis[4-(dimethylamino)phenyl]-1,1-dioxo-1,4-thiazinane-2-carboxylate.
| Compound Name | ethyl 6-(4-chlorobenzoyl)-3,5-bis[4-(dimethylamino)phenyl]-1,1-dioxo-1,4-thiazinane-2-carboxylate |
|---|---|
| PubChem CID | 45482848 |
| Molecular Formula | C30H34ClN3O5S |
| Molecular Weight | 584.14 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | ethyl 6-(4-chlorobenzoyl)-3,5-bis[4-(dimethylamino)phenyl]-1,1-dioxo-1,4-thiazinane-2-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccc(N(C)C)cc2)NC(c2ccc(N(C)C)cc2)C(C(=O)c2ccc(Cl)cc2)S1(=O)=O |
| InChI | InChI=1S/C30H34ClN3O5S/c1-6-39-30(36)29-26(20-11-17-24(18-12-20)34(4)5)32-25(19-9-15-23(16-10-19)33(2)3)28(40(29,37)38)27(35)21-7-13-22(31)14-8-21/h7-18,25-26,28-29,32H,6H2,1-5H3 |
| InChIKey | QXQGFNSRUOSMBA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|