About 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine
2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine (PubChem CID 45482887) has the molecular formula C24H29N7
and a molecular weight of 415.55 g/mol. Its IUPAC name is 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine |
| PubChem CID | 45482887 |
| Molecular Formula | C24H29N7 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(NCc3ccc(-c4ccccc4)cc3)nc(NC[C@H](C)N)nc21 |
| InChI | InChI=1S/C24H29N7/c1-16(2)31-15-28-21-22(29-24(30-23(21)31)27-13-17(3)25)26-14-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,15-17H,13-14,25H2,1-3H3,(H2,26,27,29,30)/t17-/m0/s1 |
| InChIKey | IRPWLAFDUBVBJE-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine?
The IUPAC name of 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine (CID 45482887) is 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine.
What is the SMILES notation for 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine?
The canonical SMILES for 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine is CC(C)n1cnc2c(NCc3ccc(-c4ccccc4)cc3)nc(NC[C@H](C)N)nc21.
What is the InChIKey of 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine?
The InChIKey is IRPWLAFDUBVBJE-KRWDZBQOSA-N. The full InChI is InChI=1S/C24H29N7/c1-16(2)31-15-28-21-22(29-24(30-23(21)31)27-13-17(3)25)26-14-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,15-17H,13-14,25H2,1-3H3,(H2,26,27,29,30)/t17-/m0/s1.
What are the key properties of 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine?
2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine has a molecular weight of 415.55 g/mol, XLogP of 4.45, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(2S)-2-aminopropyl]-6-N-[(4-phenylphenyl)methyl]-9-propan-2-ylpurine-2,6-diamine is sourced from PubChem (CID 45482887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).