C17H12N2O3 — CID 45482951
3-(4-methoxyphenyl)-3,7-dihydropyrrolo[3,2-f]indole-4,8-dione (PubChem CID 45482951) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3,7-dihydropyrrolo[3,2-f]indole-4,8-dione.
| Compound Name | 3-(4-methoxyphenyl)-3,7-dihydropyrrolo[3,2-f]indole-4,8-dione |
|---|---|
| PubChem CID | 45482951 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-(4-methoxyphenyl)-3,7-dihydropyrrolo[3,2-f]indole-4,8-dione |
| SMILES | COc1ccc(C2C=NC3=C2C(=O)c2cc[nH]c2C3=O)cc1 |
| InChI | InChI=1S/C17H12N2O3/c1-22-10-4-2-9(3-5-10)12-8-19-15-13(12)16(20)11-6-7-18-14(11)17(15)21/h2-8,12,18H,1H3 |
| InChIKey | GRQLFFMZGBGROO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|