C23H36N2O6 — CID 45482955
[(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-carbamoylcyclopentyl)carbamate (PubChem CID 45482955) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-carbamoylcyclopentyl)carbamate.
| Compound Name | [(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-carbamoylcyclopentyl)carbamate |
|---|---|
| PubChem CID | 45482955 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(1-carbamoylcyclopentyl)carbamate |
| SMILES | CO[C@H]1[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@]2(CC[C@H]1OC(=O)NC1(C(N)=O)CCCC1)CO2 |
| InChI | InChI=1S/C23H36N2O6/c1-14(2)7-8-16-21(3,31-16)18-17(28-4)15(9-12-23(18)13-29-23)30-20(27)25-22(19(24)26)10-5-6-11-22/h7,15-18H,5-6,8-13H2,1-4H3,(H2,24,26)(H,25,27)/t15-,16-,17-,18+,21+,23+/m1/s1 |
| InChIKey | MQIQBHVNONYWJH-GKHUVYMASA-N |
| XLogP | 2.59 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|