C31H26N6O2 — CID 45482975
(E)-1-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 45482975) has the molecular formula C31H26N6O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is (E)-1-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 45482975 |
| Molecular Formula | C31H26N6O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (E)-1-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1/C=C/C(=O)c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C31H26N6O2/c1-39-28-15-9-8-10-23(28)18-21-27(38)22-16-19-26(20-17-22)34-31-36-29(32-24-11-4-2-5-12-24)35-30(37-31)33-25-13-6-3-7-14-25/h2-21H,1H3,(H3,32,33,34,35,36,37)/b21-18+ |
| InChIKey | WJQYWUZJKKSTIK-DYTRJAOYSA-N |
| XLogP | 7.01 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|