C28H47N3O6 — CID 45482983
[(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]carbamate (PubChem CID 45482983) has the molecular formula C28H47N3O6 and a molecular weight of 521.70 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]carbamate.
| Compound Name | [(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 45482983 |
| Molecular Formula | C28H47N3O6 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | [(3R,4R,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-3-methyl-1-oxo-1-(2-pyrrolidin-1-ylethylamino)butan-2-yl]carbamate |
| SMILES | CO[C@H]1[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@]2(CC[C@H]1OC(=O)N[C@@H](C(=O)NCCN1CCCC1)C(C)C)CO2 |
| InChI | InChI=1S/C28H47N3O6/c1-18(2)9-10-21-27(5,37-21)24-23(34-6)20(11-12-28(24)17-35-28)36-26(33)30-22(19(3)4)25(32)29-13-16-31-14-7-8-15-31/h9,19-24H,7-8,10-17H2,1-6H3,(H,29,32)(H,30,33)/t20-,21-,22-,23-,24+,27+,28+/m1/s1 |
| InChIKey | TVYNZOFZJHKPKJ-QSFATTOVSA-N |
| XLogP | 3.03 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|