C23H27FO2 — CID 45483163
2-fluoro-4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]benzoic acid (PubChem CID 45483163) has the molecular formula C23H27FO2 and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-fluoro-4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]benzoic acid.
| Compound Name | 2-fluoro-4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 45483163 |
| Molecular Formula | C23H27FO2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-fluoro-4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]benzoic acid |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)O)c(F)c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H27FO2/c1-14-10-18-19(23(4,5)9-8-22(18,2)3)13-16(14)11-15-6-7-17(21(25)26)20(24)12-15/h6-7,10,12-13H,8-9,11H2,1-5H3,(H,25,26) |
| InChIKey | HLSZUZQZXROBMJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |