C19H30N2O3 — CID 45483254
(2S,3R,4R)-3,4-dihydroxy-N-(4-octylphenyl)pyrrolidine-2-carboxamide (PubChem CID 45483254) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S,3R,4R)-3,4-dihydroxy-N-(4-octylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4R)-3,4-dihydroxy-N-(4-octylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45483254 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (2S,3R,4R)-3,4-dihydroxy-N-(4-octylphenyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCCCCc1ccc(NC(=O)[C@H]2NC[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)21-19(24)17-18(23)16(22)13-20-17/h9-12,16-18,20,22-23H,2-8,13H2,1H3,(H,21,24)/t16-,17+,18+/m1/s1 |
| InChIKey | IHMKXPTZEFZPAS-SQNIBIBYSA-N |
| XLogP | 2.22 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|