C26H24ClNO3 — CID 45483289
9,10-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride (PubChem CID 45483289) has the molecular formula C26H24ClNO3 and a molecular weight of 433.94 g/mol. Its IUPAC name is 9,10-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride.
| Compound Name | 9,10-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride |
|---|---|
| PubChem CID | 45483289 |
| Molecular Formula | C26H24ClNO3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 9,10-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc(OCc2ccccc2)ccc1-3.[Cl-] |
| InChI | InChI=1S/C26H24NO3.ClH/c1-28-25-11-8-19-15-24-22-10-9-21(30-17-18-6-4-3-5-7-18)14-20(22)12-13-27(24)16-23(19)26(25)29-2;/h3-11,14-16H,12-13,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BTDZERQUXKUWMX-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|