C26H24NO3+ — CID 45483315
10,11-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 45483315) has the molecular formula C26H24NO3+ and a molecular weight of 398.48 g/mol. Its IUPAC name is 10,11-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 10,11-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 45483315 |
| Molecular Formula | C26H24NO3+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 10,11-dimethoxy-3-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | COc1cc2cc3[n+](cc2cc1OC)CCc1cc(OCc2ccccc2)ccc1-3 |
| InChI | InChI=1S/C26H24NO3/c1-28-25-14-20-13-24-23-9-8-22(30-17-18-6-4-3-5-7-18)12-19(23)10-11-27(24)16-21(20)15-26(25)29-2/h3-9,12-16H,10-11,17H2,1-2H3/q+1 |
| InChIKey | PEMJBBQAXAMQGD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|