C11H21NO4 — CID 45483515
(1S,3R,4S,5R,6R,7S)-7-(butylamino)-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptane-4,5-diol (PubChem CID 45483515) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is (1S,3R,4S,5R,6R,7S)-7-(butylamino)-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptane-4,5-diol.
| Compound Name | (1S,3R,4S,5R,6R,7S)-7-(butylamino)-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptane-4,5-diol |
|---|---|
| PubChem CID | 45483515 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | (1S,3R,4S,5R,6R,7S)-7-(butylamino)-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptane-4,5-diol |
| SMILES | CCCCN[C@@H]1[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C11H21NO4/c1-2-3-4-12-8-7-10(15)9(14)6(5-13)16-11(7)8/h6-15H,2-5H2,1H3/t6-,7-,8+,9-,10-,11+/m1/s1 |
| InChIKey | KNQLJVWKKYEBCU-PMXSCFQLSA-N |
| XLogP | -1.14 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|