C10H10BrN5 — CID 45483606
2-N-(3-bromophenyl)-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 45483606) has the molecular formula C10H10BrN5 and a molecular weight of 280.13 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-6-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-bromophenyl)-6-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 45483606 |
| Molecular Formula | C10H10BrN5 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-N-(3-bromophenyl)-6-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(N)nc(Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C10H10BrN5/c1-6-13-9(12)16-10(14-6)15-8-4-2-3-7(11)5-8/h2-5H,1H3,(H3,12,13,14,15,16) |
| InChIKey | BGUXIMMMEXKGNF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |