C31H37N3O3 — CID 45483648
methyl 3-[N-(1-benzylpiperidin-4-yl)-4-(diethylcarbamoyl)anilino]benzoate (PubChem CID 45483648) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is methyl 3-[N-(1-benzylpiperidin-4-yl)-4-(diethylcarbamoyl)anilino]benzoate.
| Compound Name | methyl 3-[N-(1-benzylpiperidin-4-yl)-4-(diethylcarbamoyl)anilino]benzoate |
|---|---|
| PubChem CID | 45483648 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | methyl 3-[N-(1-benzylpiperidin-4-yl)-4-(diethylcarbamoyl)anilino]benzoate |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2cccc(C(=O)OC)c2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-4-33(5-2)30(35)25-14-16-27(17-15-25)34(29-13-9-12-26(22-29)31(36)37-3)28-18-20-32(21-19-28)23-24-10-7-6-8-11-24/h6-17,22,28H,4-5,18-21,23H2,1-3H3 |
| InChIKey | KFKUBCFGBPRMGS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |