C28H41N9O6S — CID 45483649
(2S)-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carbonyl]amino]pentanediamide (PubChem CID 45483649) has the molecular formula C28H41N9O6S and a molecular weight of 631.76 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carbonyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carbonyl]amino]pentanediamide |
|---|---|
| PubChem CID | 45483649 |
| Molecular Formula | C28H41N9O6S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carbonyl]amino]pentanediamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N3CCC[C@H]3C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)cccc12 |
| InChI | InChI=1S/C28H41N9O6S/c1-36(2)21-10-3-8-18-17(21)7-4-12-23(18)44(42,43)37-16-6-11-22(37)27(41)35-20(13-14-24(29)38)26(40)34-19(25(30)39)9-5-15-33-28(31)32/h3-4,7-8,10,12,19-20,22H,5-6,9,11,13-16H2,1-2H3,(H2,29,38)(H2,30,39)(H,34,40)(H,35,41)(H4,31,32,33)/t19-,20-,22-/m0/s1 |
| InChIKey | BBGOBIHEYSBBEM-ONTIZHBOSA-N |
| XLogP | -1.17 |
| TPSA | 249.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|