C16H19N5O4 — CID 45483760
(E)-1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(3-imidazol-1-ylpropyl)-2-nitroethene-1,1-diamine (PubChem CID 45483760) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is (E)-1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(3-imidazol-1-ylpropyl)-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(3-imidazol-1-ylpropyl)-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 45483760 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (E)-1-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-(3-imidazol-1-ylpropyl)-2-nitroethene-1,1-diamine |
| SMILES | O=[N+]([O-])/C=C(\NCCCn1ccnc1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H19N5O4/c22-21(23)11-16(18-4-1-6-20-7-5-17-12-20)19-13-2-3-14-15(10-13)25-9-8-24-14/h2-3,5,7,10-12,18-19H,1,4,6,8-9H2/b16-11+ |
| InChIKey | SJRLWXJFFDMDKB-LFIBNONCSA-N |
| XLogP | 1.82 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|