About 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile
3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile (PubChem CID 45483823) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile |
| PubChem CID | 45483823 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile |
| SMILES | CC1(C)C/C(=N\O)c2ccc(-c3cccc(C#N)c3)cc21 |
| InChI | InChI=1S/C18H16N2O/c1-18(2)10-17(20-21)15-7-6-14(9-16(15)18)13-5-3-4-12(8-13)11-19/h3-9,21H,10H2,1-2H3/b20-17+ |
| InChIKey | JIKHATGBFZSJGW-LVZFUZTISA-N |
| XLogP | 4.08 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile?
The IUPAC name of 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile (CID 45483823) is 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile.
What is the SMILES notation for 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile?
The canonical SMILES for 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile is CC1(C)C/C(=N\O)c2ccc(-c3cccc(C#N)c3)cc21.
What is the InChIKey of 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile?
The InChIKey is JIKHATGBFZSJGW-LVZFUZTISA-N. The full InChI is InChI=1S/C18H16N2O/c1-18(2)10-17(20-21)15-7-6-14(9-16(15)18)13-5-3-4-12(8-13)11-19/h3-9,21H,10H2,1-2H3/b20-17+.
What are the key properties of 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile?
3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile has a molecular weight of 276.34 g/mol, XLogP of 4.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1E)-1-hydroxyimino-3,3-dimethyl-2H-inden-5-yl]benzonitrile is sourced from PubChem (CID 45483823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).