C20H22N4S2 — CID 45483832
6-methyl-3-[3-(5-methylimidazol-1-yl)propyl]-5-phenyl-1,4-dihydrothieno[2,3-d]pyrimidine-2-thione (PubChem CID 45483832) has the molecular formula C20H22N4S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 6-methyl-3-[3-(5-methylimidazol-1-yl)propyl]-5-phenyl-1,4-dihydrothieno[2,3-d]pyrimidine-2-thione.
| Compound Name | 6-methyl-3-[3-(5-methylimidazol-1-yl)propyl]-5-phenyl-1,4-dihydrothieno[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 45483832 |
| Molecular Formula | C20H22N4S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-methyl-3-[3-(5-methylimidazol-1-yl)propyl]-5-phenyl-1,4-dihydrothieno[2,3-d]pyrimidine-2-thione |
| SMILES | Cc1sc2c(c1-c1ccccc1)CN(CCCn1cncc1C)C(=S)N2 |
| InChI | InChI=1S/C20H22N4S2/c1-14-11-21-13-24(14)10-6-9-23-12-17-18(16-7-4-3-5-8-16)15(2)26-19(17)22-20(23)25/h3-5,7-8,11,13H,6,9-10,12H2,1-2H3,(H,22,25) |
| InChIKey | NAZRETGWZNRGHW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|