C22H28N2O4 — CID 45483843
8-[2-[[1-(4-ethylphenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-5-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 45483843) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 8-[2-[[1-(4-ethylphenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-5-hydroxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[2-[[1-(4-ethylphenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-5-hydroxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 45483843 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 8-[2-[[1-(4-ethylphenyl)-2-methylpropan-2-yl]amino]-1-hydroxyethyl]-5-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | CCc1ccc(CC(C)(C)NCC(O)c2ccc(O)c3c2OCC(=O)N3)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-4-14-5-7-15(8-6-14)11-22(2,3)23-12-18(26)16-9-10-17(25)20-21(16)28-13-19(27)24-20/h5-10,18,23,25-26H,4,11-13H2,1-3H3,(H,24,27) |
| InChIKey | YGZMWTZAPLFLCO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|