About methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate
methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate (PubChem CID 45483871) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate |
| PubChem CID | 45483871 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)C=CC1c1ccccc1 |
| InChI | InChI=1S/C20H19NO2/c1-15-19(20(22)23-2)18(16-9-5-3-6-10-16)13-14-21(15)17-11-7-4-8-12-17/h3-14,18H,1-2H3 |
| InChIKey | DWYYDKOEDVBPGW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The IUPAC name of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate (CID 45483871) is methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The canonical SMILES for methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate is COC(=O)C1=C(C)N(c2ccccc2)C=CC1c1ccccc1.
What is the InChIKey of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The InChIKey is DWYYDKOEDVBPGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO2/c1-15-19(20(22)23-2)18(16-9-5-3-6-10-16)13-14-21(15)17-11-7-4-8-12-17/h3-14,18H,1-2H3.
What are the key properties of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate has a molecular weight of 305.38 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate is sourced from PubChem (CID 45483871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).