methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate

C20H19NO2 — CID 45483871

IUPACmethyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate
SMILESCOC(=O)C1=C(C)N(c2ccccc2)C=CC1c1ccccc1
InChIInChI=1S/C20H19NO2/c1-15-19(20(22)23-2)18(16-9-5-3-6-10-16)13-14-21(15)17-11-7-4-8-12-17/h3-14,18H,1-2H3
InChIKeyDWYYDKOEDVBPGW-UHFFFAOYSA-N
MW305.38 g/mol
LogP4.25
Rot. Bonds3

About methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate

methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate (PubChem CID 45483871) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate
PubChem CID45483871
Molecular FormulaC20H19NO2
Molecular Weight305.38 g/mol
Exact Mass305.14
IUPAC Namemethyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate
SMILESCOC(=O)C1=C(C)N(c2ccccc2)C=CC1c1ccccc1
InChIInChI=1S/C20H19NO2/c1-15-19(20(22)23-2)18(16-9-5-3-6-10-16)13-14-21(15)17-11-7-4-8-12-17/h3-14,18H,1-2H3
InChIKeyDWYYDKOEDVBPGW-UHFFFAOYSA-N
XLogP4.25
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.38
LogP ≤ 54.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The IUPAC name of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate (CID 45483871) is methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The canonical SMILES for methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate is COC(=O)C1=C(C)N(c2ccccc2)C=CC1c1ccccc1.
What is the InChIKey of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The InChIKey is DWYYDKOEDVBPGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO2/c1-15-19(20(22)23-2)18(16-9-5-3-6-10-16)13-14-21(15)17-11-7-4-8-12-17/h3-14,18H,1-2H3.
What are the key properties of methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate has a molecular weight of 305.38 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate is sourced from PubChem (CID 45483871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).