About tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate
tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate (PubChem CID 45483887) has the molecular formula C23H25NO2
and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate |
| PubChem CID | 45483887 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)C(c2ccccc2)C=CN1c1ccccc1 |
| InChI | InChI=1S/C23H25NO2/c1-17-21(22(25)26-23(2,3)4)20(18-11-7-5-8-12-18)15-16-24(17)19-13-9-6-10-14-19/h5-16,20H,1-4H3 |
| InChIKey | LIJDRNAIBIRCOF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The IUPAC name of tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate (CID 45483887) is tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate.
What is the SMILES notation for tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The canonical SMILES for tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate is CC1=C(C(=O)OC(C)(C)C)C(c2ccccc2)C=CN1c1ccccc1.
What is the InChIKey of tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
The InChIKey is LIJDRNAIBIRCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO2/c1-17-21(22(25)26-23(2,3)4)20(18-11-7-5-8-12-18)15-16-24(17)19-13-9-6-10-14-19/h5-16,20H,1-4H3.
What are the key properties of tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate?
tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate has a molecular weight of 347.46 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methyl-1,4-diphenyl-4H-pyridine-3-carboxylate is sourced from PubChem (CID 45483887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).