C25H38N2O4S — CID 45483890
4-[[1-methyl-5-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]thiomorpholine (PubChem CID 45483890) has the molecular formula C25H38N2O4S and a molecular weight of 462.66 g/mol. Its IUPAC name is 4-[[1-methyl-5-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]thiomorpholine.
| Compound Name | 4-[[1-methyl-5-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]thiomorpholine |
|---|---|
| PubChem CID | 45483890 |
| Molecular Formula | C25H38N2O4S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 4-[[1-methyl-5-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrol-2-yl]methyl]thiomorpholine |
| SMILES | C[C@H]1[C@H](c2ccc(CN3CCSCC3)n2C)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H38N2O4S/c1-16-5-7-20-17(2)22(21-8-6-18(26(21)4)15-27-11-13-32-14-12-27)28-23-25(20)19(16)9-10-24(3,29-23)30-31-25/h6,8,16-17,19-20,22-23H,5,7,9-15H2,1-4H3/t16-,17-,19+,20+,22-,23-,24-,25-/m1/s1 |
| InChIKey | WTFGPWGBULVCHZ-NCKFVDEJSA-N |
| XLogP | 4.50 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|