C23H18N2O4 — CID 45484005
(3S,5S)-3-(4-hydroxyphenyl)-5-(1H-imidazol-5-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione (PubChem CID 45484005) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (3S,5S)-3-(4-hydroxyphenyl)-5-(1H-imidazol-5-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione.
| Compound Name | (3S,5S)-3-(4-hydroxyphenyl)-5-(1H-imidazol-5-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
|---|---|
| PubChem CID | 45484005 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3S,5S)-3-(4-hydroxyphenyl)-5-(1H-imidazol-5-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
| SMILES | O=C1C[C@H](c2cnc[nH]2)C2(C(=O)c3ccccc3C2=O)[C@H](c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C23H18N2O4/c26-14-7-5-13(6-8-14)18-9-15(27)10-19(20-11-24-12-25-20)23(18)21(28)16-3-1-2-4-17(16)22(23)29/h1-8,11-12,18-19,26H,9-10H2,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | XPCJTIWXGFOXFM-RBUKOAKNSA-N |
| XLogP | 3.41 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|