About 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole
2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole (PubChem CID 45484130) has the molecular formula C21H15BrN2
and a molecular weight of 375.27 g/mol. Its IUPAC name is 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole |
| PubChem CID | 45484130 |
| Molecular Formula | C21H15BrN2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole |
| SMILES | Brc1ccccc1-c1nc2c([nH]1)c1c(c3ccccc32)CCC=C1 |
| InChI | InChI=1S/C21H15BrN2/c22-18-12-6-5-11-17(18)21-23-19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)20(19)24-21/h1,3-7,9-12H,2,8H2,(H,23,24) |
| InChIKey | QIYYMMPGLAPWDD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole?
The IUPAC name of 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole (CID 45484130) is 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole.
What is the SMILES notation for 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole?
The canonical SMILES for 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole is Brc1ccccc1-c1nc2c([nH]1)c1c(c3ccccc32)CCC=C1.
What is the InChIKey of 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole?
The InChIKey is QIYYMMPGLAPWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15BrN2/c22-18-12-6-5-11-17(18)21-23-19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)20(19)24-21/h1,3-7,9-12H,2,8H2,(H,23,24).
What are the key properties of 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole?
2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole has a molecular weight of 375.27 g/mol, XLogP of 6.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-8,9-dihydro-1H-phenanthro[9,10-d]imidazole is sourced from PubChem (CID 45484130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).