About 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline
6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline (PubChem CID 45484204) has the molecular formula C20H23NO2
and a molecular weight of 309.41 g/mol. Its IUPAC name is 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline |
| PubChem CID | 45484204 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline |
| SMILES | COc1ccccc1COc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C20H23NO2/c1-14-12-20(2,3)21-18-10-9-16(11-17(14)18)23-13-15-7-5-6-8-19(15)22-4/h5-12,21H,13H2,1-4H3 |
| InChIKey | LRKDQQGYCQHWHH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline?
The IUPAC name of 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline (CID 45484204) is 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline.
What is the SMILES notation for 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline?
The canonical SMILES for 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline is COc1ccccc1COc1ccc2c(c1)C(C)=CC(C)(C)N2.
What is the InChIKey of 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline?
The InChIKey is LRKDQQGYCQHWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2/c1-14-12-20(2,3)21-18-10-9-16(11-17(14)18)23-13-15-7-5-6-8-19(15)22-4/h5-12,21H,13H2,1-4H3.
What are the key properties of 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline?
6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline has a molecular weight of 309.41 g/mol, XLogP of 4.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-methoxyphenyl)methoxy]-2,2,4-trimethyl-1H-quinoline is sourced from PubChem (CID 45484204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).