About 1-benzyl-2,2,4-trimethylquinolin-6-ol
1-benzyl-2,2,4-trimethylquinolin-6-ol (PubChem CID 45484215) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-benzyl-2,2,4-trimethylquinolin-6-ol.
Molecular Properties
| Compound Name | 1-benzyl-2,2,4-trimethylquinolin-6-ol |
| PubChem CID | 45484215 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-benzyl-2,2,4-trimethylquinolin-6-ol |
| SMILES | CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(O)cc21 |
| InChI | InChI=1S/C19H21NO/c1-14-12-19(2,3)20(13-15-7-5-4-6-8-15)18-10-9-16(21)11-17(14)18/h4-12,21H,13H2,1-3H3 |
| InChIKey | ONSASDVFHRWHJX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2,2,4-trimethylquinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,2,4-trimethylquinolin-6-ol?
The IUPAC name of 1-benzyl-2,2,4-trimethylquinolin-6-ol (CID 45484215) is 1-benzyl-2,2,4-trimethylquinolin-6-ol.
What is the SMILES notation for 1-benzyl-2,2,4-trimethylquinolin-6-ol?
The canonical SMILES for 1-benzyl-2,2,4-trimethylquinolin-6-ol is CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(O)cc21.
What is the InChIKey of 1-benzyl-2,2,4-trimethylquinolin-6-ol?
The InChIKey is ONSASDVFHRWHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO/c1-14-12-19(2,3)20(13-15-7-5-4-6-8-15)18-10-9-16(21)11-17(14)18/h4-12,21H,13H2,1-3H3.
What are the key properties of 1-benzyl-2,2,4-trimethylquinolin-6-ol?
1-benzyl-2,2,4-trimethylquinolin-6-ol has a molecular weight of 279.38 g/mol, XLogP of 4.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,2,4-trimethylquinolin-6-ol is sourced from PubChem (CID 45484215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).