C24H29NO2 — CID 45484233
(1-benzyl-2,2,4-trimethylquinolin-6-yl) 2,2-dimethylpropanoate (PubChem CID 45484233) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (1-benzyl-2,2,4-trimethylquinolin-6-yl) 2,2-dimethylpropanoate.
| Compound Name | (1-benzyl-2,2,4-trimethylquinolin-6-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 45484233 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (1-benzyl-2,2,4-trimethylquinolin-6-yl) 2,2-dimethylpropanoate |
| SMILES | CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(OC(=O)C(C)(C)C)cc21 |
| InChI | InChI=1S/C24H29NO2/c1-17-15-24(5,6)25(16-18-10-8-7-9-11-18)21-13-12-19(14-20(17)21)27-22(26)23(2,3)4/h7-15H,16H2,1-6H3 |
| InChIKey | OBYWNWOZSUJSFW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|