C25H24O8 — CID 45484236
prop-2-enyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate (PubChem CID 45484236) has the molecular formula C25H24O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is prop-2-enyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate.
| Compound Name | prop-2-enyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate |
|---|---|
| PubChem CID | 45484236 |
| Molecular Formula | C25H24O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | prop-2-enyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1C(C=O)=Cc2cc3c(cc2[C@H]1c1cc(OC)c(OC)c(OC)c1)OCO3 |
| InChI | InChI=1S/C25H24O8/c1-5-6-31-25(27)23-16(12-26)7-14-8-18-19(33-13-32-18)11-17(14)22(23)15-9-20(28-2)24(30-4)21(10-15)29-3/h5,7-12,22-23H,1,6,13H2,2-4H3/t22-,23-/m1/s1 |
| InChIKey | XLAXMGXLFFMTSA-DHIUTWEWSA-N |
| XLogP | 3.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|