C26H31NO2 — CID 45484260
(1-benzyl-2,2,4-trimethylquinolin-6-yl) cyclohexanecarboxylate (PubChem CID 45484260) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (1-benzyl-2,2,4-trimethylquinolin-6-yl) cyclohexanecarboxylate.
| Compound Name | (1-benzyl-2,2,4-trimethylquinolin-6-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 45484260 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (1-benzyl-2,2,4-trimethylquinolin-6-yl) cyclohexanecarboxylate |
| SMILES | CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(OC(=O)C3CCCCC3)cc21 |
| InChI | InChI=1S/C26H31NO2/c1-19-17-26(2,3)27(18-20-10-6-4-7-11-20)24-15-14-22(16-23(19)24)29-25(28)21-12-8-5-9-13-21/h4,6-7,10-11,14-17,21H,5,8-9,12-13,18H2,1-3H3 |
| InChIKey | RKELUXGAIJVKNI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|