C28H29NO4 — CID 45484273
(1-benzyl-2,2,4-trimethylquinolin-6-yl) 3,5-dimethoxybenzoate (PubChem CID 45484273) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (1-benzyl-2,2,4-trimethylquinolin-6-yl) 3,5-dimethoxybenzoate.
| Compound Name | (1-benzyl-2,2,4-trimethylquinolin-6-yl) 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 45484273 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (1-benzyl-2,2,4-trimethylquinolin-6-yl) 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2ccc3c(c2)C(C)=CC(C)(C)N3Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H29NO4/c1-19-17-28(2,3)29(18-20-9-7-6-8-10-20)26-12-11-22(16-25(19)26)33-27(30)21-13-23(31-4)15-24(14-21)32-5/h6-17H,18H2,1-5H3 |
| InChIKey | WSXCKCWCLWUFKT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|