C22H29NO4 — CID 45484351
(1S,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(2-phenylethyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 45484351) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (1S,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(2-phenylethyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1S,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(2-phenylethyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 45484351 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (1S,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(2-phenylethyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2CC(=O)N(CCc3ccccc3)[C@@H]3O[C@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C22H29NO4/c1-15-8-9-17-14-19(24)23(13-11-16-6-4-3-5-7-16)20-22(17)18(15)10-12-21(2,25-20)26-27-22/h3-7,15,17-18,20H,8-14H2,1-2H3/t15-,17+,18+,20-,21+,22+/m1/s1 |
| InChIKey | COPFMDWZDDWXEP-WFBMNYBESA-N |
| XLogP | 3.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|