C20H18N4O4S3 — CID 45484484
5-N,7-N-bis[(E)-1-thiophen-2-ylethylideneamino]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxamide (PubChem CID 45484484) has the molecular formula C20H18N4O4S3 and a molecular weight of 474.59 g/mol. Its IUPAC name is 5-N,7-N-bis[(E)-1-thiophen-2-ylethylideneamino]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxamide.
| Compound Name | 5-N,7-N-bis[(E)-1-thiophen-2-ylethylideneamino]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 45484484 |
| Molecular Formula | C20H18N4O4S3 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 5-N,7-N-bis[(E)-1-thiophen-2-ylethylideneamino]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1sc(C(=O)N/N=C(\C)c2cccs2)c2c1OCCO2)c1cccs1 |
| InChI | InChI=1S/C20H18N4O4S3/c1-11(13-5-3-9-29-13)21-23-19(25)17-15-16(28-8-7-27-15)18(31-17)20(26)24-22-12(2)14-6-4-10-30-14/h3-6,9-10H,7-8H2,1-2H3,(H,23,25)(H,24,26)/b21-11+,22-12+ |
| InChIKey | ZWSFQBDDUCIKOU-XHQRYOPUSA-N |
| XLogP | 3.95 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|