C22H28N6O — CID 45484567
N-(3-aminopropyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide (PubChem CID 45484567) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(3-aminopropyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 45484567 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N-(3-aminopropyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CN(Cc1nc2c(C(=O)NCCCN)cccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C22H28N6O/c1-28(18-10-2-6-15-7-4-12-24-20(15)18)14-19-26-17-9-3-8-16(21(17)27-19)22(29)25-13-5-11-23/h3-4,7-9,12,18H,2,5-6,10-11,13-14,23H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | FWLUMBYTIIJUCR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|