C23H30N6O — CID 45484618
N-(4-aminobutyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide (PubChem CID 45484618) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(4-aminobutyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 45484618 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | N-(4-aminobutyl)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CN(Cc1nc2c(C(=O)NCCCCN)cccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C23H30N6O/c1-29(19-11-4-7-16-8-6-14-25-21(16)19)15-20-27-18-10-5-9-17(22(18)28-20)23(30)26-13-3-2-12-24/h5-6,8-10,14,19H,2-4,7,11-13,15,24H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | LQVUNQPJWCYVCI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|