C14H17N3O — CID 45484701
1-benzyl-2,4,5,6,7,8-hexahydropyrazolo[3,4-d]azepin-3-one (PubChem CID 45484701) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-benzyl-2,4,5,6,7,8-hexahydropyrazolo[3,4-d]azepin-3-one.
| Compound Name | 1-benzyl-2,4,5,6,7,8-hexahydropyrazolo[3,4-d]azepin-3-one |
|---|---|
| PubChem CID | 45484701 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-benzyl-2,4,5,6,7,8-hexahydropyrazolo[3,4-d]azepin-3-one |
| SMILES | O=c1[nH]n(Cc2ccccc2)c2c1CCNCC2 |
| InChI | InChI=1S/C14H17N3O/c18-14-12-6-8-15-9-7-13(12)17(16-14)10-11-4-2-1-3-5-11/h1-5,15H,6-10H2,(H,16,18) |
| InChIKey | AQEVTTPQORHLEG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |