C26H33N3O2S — CID 45485072
4-(2-benzylimino-1,3-thiazepan-3-yl)-1-methyl-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 45485072) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is 4-(2-benzylimino-1,3-thiazepan-3-yl)-1-methyl-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 4-(2-benzylimino-1,3-thiazepan-3-yl)-1-methyl-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 45485072 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 4-(2-benzylimino-1,3-thiazepan-3-yl)-1-methyl-7-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CC(C)C12C=CC(C)(CC1)C1C(=O)N(N3CCCCS/C3=N\Cc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C26H33N3O2S/c1-18(2)26-13-11-25(3,12-14-26)20-21(26)23(31)29(22(20)30)28-15-7-8-16-32-24(28)27-17-19-9-5-4-6-10-19/h4-6,9-11,13,18,20-21H,7-8,12,14-17H2,1-3H3/b27-24- |
| InChIKey | LLWQKVNCVOMJFF-PNHLSOANSA-N |
| XLogP | 4.90 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|