C24H26N4OS — CID 45485225
4-(butylamino)-8-methyl-5-phenyl-11-thia-3,5,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,7,9,12(17)-pentaen-6-one (PubChem CID 45485225) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 4-(butylamino)-8-methyl-5-phenyl-11-thia-3,5,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,7,9,12(17)-pentaen-6-one.
| Compound Name | 4-(butylamino)-8-methyl-5-phenyl-11-thia-3,5,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,7,9,12(17)-pentaen-6-one |
|---|---|
| PubChem CID | 45485225 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-(butylamino)-8-methyl-5-phenyl-11-thia-3,5,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,7,9,12(17)-pentaen-6-one |
| SMILES | CCCCNc1nc2c(c(C)nc3sc4c(c32)CCCC4)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H26N4OS/c1-3-4-14-25-24-27-21-19(23(29)28(24)16-10-6-5-7-11-16)15(2)26-22-20(21)17-12-8-9-13-18(17)30-22/h5-7,10-11H,3-4,8-9,12-14H2,1-2H3,(H,25,27) |
| InChIKey | SRAFQWTXDRRPSO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|