C9H14N6 — CID 45485275
6,7,7-trimethyl-8H-pteridine-2,4-diamine (PubChem CID 45485275) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is 6,7,7-trimethyl-8H-pteridine-2,4-diamine.
| Compound Name | 6,7,7-trimethyl-8H-pteridine-2,4-diamine |
|---|---|
| PubChem CID | 45485275 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6,7,7-trimethyl-8H-pteridine-2,4-diamine |
| SMILES | CC1=Nc2c(N)nc(N)nc2NC1(C)C |
| InChI | InChI=1S/C9H14N6/c1-4-9(2,3)15-7-5(12-4)6(10)13-8(11)14-7/h1-3H3,(H5,10,11,13,14,15) |
| InChIKey | GDXJTHGAKWYHNK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |